CAS 136765-31-6 appears in our catalog under these names: Dothiepin-d3, Dosulepin-d3. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg.
(3E)-N,N-dimethyl-3-(1,2,3-trideuterio-6H-benzo[c][1]benzothiepin-11-ylidene)propan-1-amine (CAS 136765-31-6) is a chemical compound with the molecular formula C19H21NS and a molecular weight of 298.5 g/mol. IUPAC name: (3E)-N,N-dimethyl-3-(1,2,3-trideuterio-6H-benzo[c][1]benzothiepin-11-ylidene)propan-1-amine. InChIKey: PHTUQLWOUWZIMZ-TVUQWVDKSA-N.
| Molecular formula | C19H21NS |
|---|---|
| Molecular weight | 298.5 g/mol |
| IUPAC name | (3E)-N,N-dimethyl-3-(1,2,3-trideuterio-6H-benzo[c][1]benzothiepin-11-ylidene)propan-1-amine |
| InChIKey | PHTUQLWOUWZIMZ-TVUQWVDKSA-N |
| SMILES | [2H]C1=C(C(=C\2C(=C1)SCC3=CC=CC=C3/C2=C\CCN(C)C)[2H])[2H] |
Computed by PubChem (NCBI)