CAS 136773-69-8 appears in our catalog under these names: 4-Chloro-7-fluoropyrrolo(1,2-a)quinoxaline, 4-Chloro-7-fluoropyrrolo(1,2-a)quinoxaline, 98%, 4–Chloro–7–fluoropyrrolo(1,2–a)quinoxaline, 4-Chloro-7-fluoropyrrolo[1,2-a]quinoxaline 98%, 4-Chloro-7-fluoropyrrolo[1,2-a]quinoxaline, 98%, 98%. Offered by: TRC, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 100mg, 250mg, 1g, 100 mg, 25 mg, 50 mg, 10 mg.
4-chloro-7-fluoropyrrolo[1,2-a]quinoxaline (CAS 136773-69-8) is a chemical compound with the molecular formula C11H6ClFN2 and a molecular weight of 220.63 g/mol. IUPAC name: 4-chloro-7-fluoropyrrolo[1,2-a]quinoxaline. InChIKey: NONXBGJFBUNSAD-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFN2 |
|---|---|
| Molecular weight | 220.63 g/mol |
| IUPAC name | 4-chloro-7-fluoropyrrolo[1,2-a]quinoxaline |
| InChIKey | NONXBGJFBUNSAD-UHFFFAOYSA-N |
| SMILES | C1=CN2C3=C(C=C(C=C3)F)N=C(C2=C1)Cl |
Computed by PubChem (NCBI)