CAS 1367907-59-2 is the registry number for 8-Bromochroman-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-3,4-dihydro-2H-chromen-6-amine (CAS 1367907-59-2) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-chromen-6-amine. InChIKey: OZHOZOWAIARYLC-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-chromen-6-amine |
| InChIKey | OZHOZOWAIARYLC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)N)Br)OC1 |
Computed by PubChem (NCBI)