Products 1367937-00-5

CAS 1367937-00-5 is the registry number for 5-Amino-4-bromothiophene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-amino-4-bromothiophene-2-carboxylic acid (CAS 1367937-00-5) is a chemical compound with the molecular formula C5H4BrNO2S and a molecular weight of 222.06 g/mol. IUPAC name: 5-amino-4-bromothiophene-2-carboxylic acid. InChIKey: LGULHFRXMKEWPD-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BrNO2S
Molecular weight222.06 g/mol
IUPAC name5-amino-4-bromothiophene-2-carboxylic acid
InChIKeyLGULHFRXMKEWPD-UHFFFAOYSA-N
SMILESC1=C(SC(=C1Br)N)C(=O)O

Computed by PubChem (NCBI)