CAS 13681-87-3 appears in our catalog under these names: Diethyldithiocarbamic acid copper salt, 97%, Copper(II) Diethyldithiocarbamate, DIETHYLDITHIOCARBAMIC ACID COPPER SALT/ 98.56% (existing batch purity), Copper(II) diethyldithiocarbamate, Copper(II) Diethyldithiocarbamate, >97.0%(T). Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, TCI. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 250g, 100g, 5mg.
Copper bis(N,N-diethylcarbamodithioate) (CAS 13681-87-3) is a chemical compound with the molecular formula C10H20CuN2S4 and a molecular weight of 360.1 g/mol. IUPAC name: copper bis(N,N-diethylcarbamodithioate). InChIKey: OBBCYCYCTJQCCK-UHFFFAOYSA-L.
| Molecular formula | C10H20CuN2S4 |
|---|---|
| Molecular weight | 360.1 g/mol |
| IUPAC name | copper bis(N,N-diethylcarbamodithioate) |
| InChIKey | OBBCYCYCTJQCCK-UHFFFAOYSA-L |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Cu+2] |
Computed by PubChem (NCBI)