CAS 136814-99-8 is the registry number for N–Acetyl–2–(4–fluoro–phenyl)–D–glycine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-acetamido-2-(4-fluorophenyl)acetic acid (CAS 136814-99-8) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: (2R)-2-acetamido-2-(4-fluorophenyl)acetic acid. InChIKey: HZTADRWBVNKKSJ-SECBINFHSA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | (2R)-2-acetamido-2-(4-fluorophenyl)acetic acid |
| InChIKey | HZTADRWBVNKKSJ-SECBINFHSA-N |
| SMILES | CC(=O)N[C@H](C1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)