CAS 1368166-27-1 is the registry number for 2-(2-tert-Butyl-1,3-oxazol-5-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2-tert-butyl-1,3-oxazol-5-yl)acetic acid (CAS 1368166-27-1) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 2-(2-tert-butyl-1,3-oxazol-5-yl)acetic acid. InChIKey: QAICLZYLFHYTNQ-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 2-(2-tert-butyl-1,3-oxazol-5-yl)acetic acid |
| InChIKey | QAICLZYLFHYTNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC=C(O1)CC(=O)O |
Computed by PubChem (NCBI)