CAS 1368588-54-8 appears in our catalog under these names: 7-bromo-3-methyl-2,3-dihydro-1H-indol-2-one, 97%, 7-Bromo-3-methyl-2,3-dihydro-1H-indol-2-one, 7-Bromo-3-methyl-2,3-dihydro-1H-indol-2-one, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 0,5g, 50mg, 100mg, 250mg, 1g.
7-bromo-3-methyl-1,3-dihydroindol-2-one (CAS 1368588-54-8) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 7-bromo-3-methyl-1,3-dihydroindol-2-one. InChIKey: VVLQFCCRKKZWQR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 7-bromo-3-methyl-1,3-dihydroindol-2-one |
| InChIKey | VVLQFCCRKKZWQR-UHFFFAOYSA-N |
| SMILES | CC1C2=C(C(=CC=C2)Br)NC1=O |
Computed by PubChem (NCBI)