CAS 1368693-23-5 appears in our catalog under these names: (1–(3–fluoro–4–methoxyphenyl)cyclopropyl)methanamine hydrochloride, [1-(3-fluoro-4-methoxyphenyl)cyclopropyl]methanamine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 50mg.
[1-(3-fluoro-4-methoxyphenyl)cyclopropyl]methanamine (CAS 1368693-23-5) is a chemical compound with the molecular formula C11H14FNO and a molecular weight of 195.23 g/mol. IUPAC name: [1-(3-fluoro-4-methoxyphenyl)cyclopropyl]methanamine. InChIKey: KWCUQRAMQIEHQQ-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO |
|---|---|
| Molecular weight | 195.23 g/mol |
| IUPAC name | [1-(3-fluoro-4-methoxyphenyl)cyclopropyl]methanamine |
| InChIKey | KWCUQRAMQIEHQQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CC2)CN)F |
Computed by PubChem (NCBI)