CAS 1368963-87-4 is the registry number for N–Methyl–2–(4–(trifluoromethyl)phenyl)propan–2–amine. Offered by: GLPBio. Available pack sizes: 25mg.
N-methyl-2-[4-(trifluoromethyl)phenyl]propan-2-amine (CAS 1368963-87-4) is a chemical compound with the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. IUPAC name: N-methyl-2-[4-(trifluoromethyl)phenyl]propan-2-amine. InChIKey: JSIYDUPQTJOTDF-UHFFFAOYSA-N.
| Molecular formula | C11H14F3N |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | N-methyl-2-[4-(trifluoromethyl)phenyl]propan-2-amine |
| InChIKey | JSIYDUPQTJOTDF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(F)(F)F)NC |
Computed by PubChem (NCBI)