Products 1369053-34-8
CAS 1369053-34-8 is the registry number for 1-(1-(2,5-Difluorophenyl)cyclopentyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[1-(2,5-difluorophenyl)cyclopentyl]methanamine (CAS 1369053-34-8) is a chemical compound with the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. IUPAC name: [1-(2,5-difluorophenyl)cyclopentyl]methanamine. InChIKey: BVQMVRVRHIGBKJ-UHFFFAOYSA-N.
| Molecular formula | C12H15F2N |
|---|---|
| Molecular weight | 211.25 g/mol |
| IUPAC name | [1-(2,5-difluorophenyl)cyclopentyl]methanamine |
| InChIKey | BVQMVRVRHIGBKJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CN)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)