CAS 13691-92-4 appears in our catalog under these names: N-(4-Chloro-3-(trifluoromethyl)phenyl)-2,2-dimethylpropanamide, N-(4-Chloro-3-(trifluoromethyl)phenyl)-2,2-dimethylpropanamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
N-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide (CAS 13691-92-4) is a chemical compound with the molecular formula C12H13ClF3NO and a molecular weight of 279.68 g/mol. IUPAC name: N-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide. InChIKey: PBVCSEASIYSIDH-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3NO |
|---|---|
| Molecular weight | 279.68 g/mol |
| IUPAC name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | PBVCSEASIYSIDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)