CAS 1369773-39-6 appears in our catalog under these names: Sacubitril Calcium, >95% (HPLC), Sacubitril hemicalcium salt/ 99.93% (existing batch purity), AHU–377 hemicalcium salt, Sacubitril calcium, Sacubitril hemicalcium salt, 99.82%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 2mg, 5mg, 10mg, 25mg, 50mg.
Calcium bis(4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoate) (CAS 1369773-39-6) is a chemical compound with the molecular formula C48H56CaN2O10 and a molecular weight of 861.0 g/mol. IUPAC name: calcium bis(4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoate). InChIKey: DDLCKLBRBPYKQS-OXXXZDCLSA-L.
| Molecular formula | C48H56CaN2O10 |
|---|---|
| Molecular weight | 861.0 g/mol |
| IUPAC name | calcium bis(4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoate) |
| InChIKey | DDLCKLBRBPYKQS-OXXXZDCLSA-L |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)[O-].CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)