Products 1369779-06-5

CAS 1369779-06-5 is the registry number for 2-Bromo-1,3-diiodobenzene 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-bromo-1,3-diiodobenzene (CAS 1369779-06-5) is a chemical compound with the molecular formula C6H3BrI2 and a molecular weight of 408.80 g/mol. IUPAC name: 2-bromo-1,3-diiodobenzene. InChIKey: GKODZJGUKYFQSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrI2
Molecular weight408.80 g/mol
IUPAC name2-bromo-1,3-diiodobenzene
InChIKeyGKODZJGUKYFQSQ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)I)Br)I

Computed by PubChem (NCBI)