Products 1369779-38-3

CAS 1369779-38-3 appears in our catalog under these names: Rivastigmine Impurity 5, Rivastigmine Impurity 1. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.

Structural formula: {0} (CAS {1})

(1S)-1-(3-hydroxyphenyl)-N,N-dimethylethanamine oxide (CAS 1369779-38-3) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: (1S)-1-(3-hydroxyphenyl)-N,N-dimethylethanamine oxide. InChIKey: IKJXNUVVPHBWRX-QMMMGPOBSA-N.

Identity
Molecular formulaC10H15NO2
Molecular weight181.23 g/mol
IUPAC name(1S)-1-(3-hydroxyphenyl)-N,N-dimethylethanamine oxide
InChIKeyIKJXNUVVPHBWRX-QMMMGPOBSA-N
SMILESC[C@@H](C1=CC(=CC=C1)O)[N+](C)(C)[O-]

Computed by PubChem (NCBI)