CAS 1369779-38-3 appears in our catalog under these names: Rivastigmine Impurity 5, Rivastigmine Impurity 1. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
(1S)-1-(3-hydroxyphenyl)-N,N-dimethylethanamine oxide (CAS 1369779-38-3) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: (1S)-1-(3-hydroxyphenyl)-N,N-dimethylethanamine oxide. InChIKey: IKJXNUVVPHBWRX-QMMMGPOBSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (1S)-1-(3-hydroxyphenyl)-N,N-dimethylethanamine oxide |
| InChIKey | IKJXNUVVPHBWRX-QMMMGPOBSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)O)[N+](C)(C)[O-] |
Computed by PubChem (NCBI)