CAS 1369817-11-7 is the registry number for 3,4-diisopropoxybenzamide. Offered by: TRC. Available pack sizes: 250mg.
3,4-di(propan-2-yloxy)benzamide (CAS 1369817-11-7) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: 3,4-di(propan-2-yloxy)benzamide. InChIKey: HMSQSJDVLYULNT-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | 3,4-di(propan-2-yloxy)benzamide |
| InChIKey | HMSQSJDVLYULNT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C(=O)N)OC(C)C |
Computed by PubChem (NCBI)