Products 1369850-19-0

CAS 1369850-19-0 is the registry number for 6-Cyanopyrimidine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-cyanopyrimidine-4-carboxylic acid (CAS 1369850-19-0) is a chemical compound with the molecular formula C6H3N3O2 and a molecular weight of 149.11 g/mol. IUPAC name: 6-cyanopyrimidine-4-carboxylic acid. InChIKey: WKBZIMALGITKOW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3N3O2
Molecular weight149.11 g/mol
IUPAC name6-cyanopyrimidine-4-carboxylic acid
InChIKeyWKBZIMALGITKOW-UHFFFAOYSA-N
SMILESC1=C(N=CN=C1C(=O)O)C#N

Computed by PubChem (NCBI)