CAS 1369854-05-6 appears in our catalog under these names: 2-Ethyl-1-fluoro-4-nitrobenzene, 95%, 2–Ethyl–1–fluoro–4–nitrobenzene, 2-Ethyl-1-fluoro-4-nitrobenzene. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,05g, 0,1g, 0,25g, 0,5g.
2-ethyl-1-fluoro-4-nitrobenzene (CAS 1369854-05-6) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: 2-ethyl-1-fluoro-4-nitrobenzene. InChIKey: QMNYNWPOUAMKGG-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | 2-ethyl-1-fluoro-4-nitrobenzene |
| InChIKey | QMNYNWPOUAMKGG-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)