CAS 1369875-40-0 is the registry number for 2-(tert-Butoxy)-1,3-dichlorobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dichloro-2-[(2-methylpropan-2-yl)oxy]benzene (CAS 1369875-40-0) is a chemical compound with the molecular formula C10H12Cl2O and a molecular weight of 219.10 g/mol. IUPAC name: 1,3-dichloro-2-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: MUZXNPCPMVFKRK-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O |
|---|---|
| Molecular weight | 219.10 g/mol |
| IUPAC name | 1,3-dichloro-2-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | MUZXNPCPMVFKRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)