Products 1369935-29-4
CAS 1369935-29-4 is the registry number for 1-Chloro-4-(1,1-dimethylethyl)-2-fluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-tert-butyl-1-chloro-2-fluorobenzene (CAS 1369935-29-4) is a chemical compound with the molecular formula C10H12ClF and a molecular weight of 186.65 g/mol. IUPAC name: 4-tert-butyl-1-chloro-2-fluorobenzene. InChIKey: YXNMDUNJLASLES-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF |
|---|---|
| Molecular weight | 186.65 g/mol |
| IUPAC name | 4-tert-butyl-1-chloro-2-fluorobenzene |
| InChIKey | YXNMDUNJLASLES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Cl)F |
Computed by PubChem (NCBI)