CAS 1369955-63-4 appears in our catalog under these names: 1-Iodo-3-methyl-2-(trifluoromethyl)benzene, 95%, 95%, 1-Iodo-3-methyl-2-(trifluoromethyl)benzene, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
1-iodo-3-methyl-2-(trifluoromethyl)benzene (CAS 1369955-63-4) is a chemical compound with the molecular formula C8H6F3I and a molecular weight of 286.03 g/mol. IUPAC name: 1-iodo-3-methyl-2-(trifluoromethyl)benzene. InChIKey: HCLHQKWSMPFJNB-UHFFFAOYSA-N.
| Molecular formula | C8H6F3I |
|---|---|
| Molecular weight | 286.03 g/mol |
| IUPAC name | 1-iodo-3-methyl-2-(trifluoromethyl)benzene |
| InChIKey | HCLHQKWSMPFJNB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)I)C(F)(F)F |
Computed by PubChem (NCBI)