Products 137-19-9
CAS 137-19-9 appears in our catalog under these names: 4,6-Dichlororesorcinol, 97%, Phloroglucinol EP Impurity O (4,6-Dichlororesorcinol), Dichlororesorcinol, >95% (GC), 4,6–Dichlororesorcinol, 4,6-Dichlororesorcinol. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 25g, 1g, 5g, on request, 10g, 2,5g, 100g, 50g.
4,6-dichlorobenzene-1,3-diol (CAS 137-19-9) is a chemical compound with the molecular formula C6H4Cl2O2 and a molecular weight of 179.00 g/mol. IUPAC name: 4,6-dichlorobenzene-1,3-diol. InChIKey: GRLQBYQELUWBIO-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O2 |
|---|---|
| Molecular weight | 179.00 g/mol |
| IUPAC name | 4,6-dichlorobenzene-1,3-diol |
| InChIKey | GRLQBYQELUWBIO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)Cl)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
4,6-Dichlororesorcinol, 1,3-Benzenediol, 4,6-dichloro-, Resorcinol, 4,6-dichloro-, 4,6-Dichloro-1,3-dihydroxybenzene, Resorcinol, 4,6-dichloro-(8CI), InChI=1/C6H4Cl2O2/c7-3-1-4(8)6(10)2-5(3)9/h1-2,9-10, 4,6-dichlorobenzene-1,3-diol, 4,6-Dichloro-1,3-benzenediol, dichlororesorcinol, 4,3-dihydroxybenzene