CAS 137-29-1 appears in our catalog under these names: Copper dimethyldithiocarbamate, 95%, Copper(II) Dimethyldithiocarbamate, Copper(II) Dimethyldithiocarbamate, >98.0%(T), Copperdimethyldithiocarbamate 98%, Copperdimethyldithiocarbamate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g.
Copper bis(N,N-dimethylcarbamodithioate) (CAS 137-29-1) is a chemical compound with the molecular formula C6H12CuN2S4 and a molecular weight of 304.0 g/mol. IUPAC name: copper bis(N,N-dimethylcarbamodithioate). InChIKey: ZOUQIAGHKFLHIA-UHFFFAOYSA-L.
| Molecular formula | C6H12CuN2S4 |
|---|---|
| Molecular weight | 304.0 g/mol |
| IUPAC name | copper bis(N,N-dimethylcarbamodithioate) |
| InChIKey | ZOUQIAGHKFLHIA-UHFFFAOYSA-L |
| SMILES | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Cu+2] |
Computed by PubChem (NCBI)