CAS 137-64-4 appears in our catalog under these names: 2-Chloro-5-chlorosulfonyl-benzoic acid, 97%, 2-Chloro-5-(chlorosulfonyl)benzoic acid, 98%, 2-Chloro-5-chlorosulfonylbenzoic Acid, 2–Chloro–5–chlorosulfonyl–benzoic acid, 5-(Chlorosulfonyl)-2-chlorobenzoic acid, 97%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, on request, 500mg.
2-chloro-5-chlorosulfonylbenzoic acid (CAS 137-64-4) is a chemical compound with the molecular formula C7H4Cl2O4S and a molecular weight of 255.07 g/mol. IUPAC name: 2-chloro-5-chlorosulfonylbenzoic acid. InChIKey: CLHNTBSDCJLCKV-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O4S |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 2-chloro-5-chlorosulfonylbenzoic acid |
| InChIKey | CLHNTBSDCJLCKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)