Products 1370001-71-0
CAS 1370001-71-0 is the registry number for BMS-351. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-methyl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)benzimidazole (CAS 1370001-71-0) is a chemical compound with the molecular formula C15H12F3N3 and a molecular weight of 291.27 g/mol. IUPAC name: 4-(4-methyl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)benzimidazole. InChIKey: OFFVLUDFSIUVMI-UHFFFAOYSA-N.
| Molecular formula | C15H12F3N3 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | 4-(4-methyl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)benzimidazole |
| InChIKey | OFFVLUDFSIUVMI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1)C2=C3C(=CC=C2)N(C=N3)CC(F)(F)F |
Computed by PubChem (NCBI)