CAS 1370261-97-4 appears in our catalog under these names: PRT062607 HCl, 98%, PRT062607 hydrochloride/ 99.93% (existing batch purity), PRT062607 Hydrochloride, PRT062607 (P505-15) HCl, PRT062607 HCl 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 200mg, 100mg.
2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide;hydrochloride (CAS 1370261-97-4) is a chemical compound with the molecular formula C19H24ClN9O and a molecular weight of 429.9 g/mol. IUPAC name: 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide;hydrochloride. InChIKey: RMNLLPXCNDZJMJ-IDVLALEDSA-N.
| Molecular formula | C19H24ClN9O |
|---|---|
| Molecular weight | 429.9 g/mol |
| IUPAC name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide;hydrochloride |
| InChIKey | RMNLLPXCNDZJMJ-IDVLALEDSA-N |
| SMILES | C1CC[C@H]([C@H](C1)N)NC2=NC=C(C(=N2)NC3=CC(=CC=C3)N4N=CC=N4)C(=O)N.Cl |
Computed by PubChem (NCBI)