Products 1370320-64-1
CAS 1370320-64-1 is the registry number for 2-(2-Iodophenyl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-(2-iodophenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (CAS 1370320-64-1) is a chemical compound with the molecular formula C16H12BIN2 and a molecular weight of 370.0 g/mol. IUPAC name: 3-(2-iodophenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene. InChIKey: KEEAUWRRDPUXST-UHFFFAOYSA-N.
| Molecular formula | C16H12BIN2 |
|---|---|
| Molecular weight | 370.0 g/mol |
| IUPAC name | 3-(2-iodophenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| InChIKey | KEEAUWRRDPUXST-UHFFFAOYSA-N |
| SMILES | B1(NC2=CC=CC3=C2C(=CC=C3)N1)C4=CC=CC=C4I |
Computed by PubChem (NCBI)