CAS 2724208-15-3 is the registry number for 2-(3-Iodophenyl)-2,3-dihydro-1h-naphtho[1,8-de][1,3,2]diazaborinine, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(3-iodophenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (CAS 2724208-15-3) is a chemical compound with the molecular formula C16H12BIN2 and a molecular weight of 370.0 g/mol. IUPAC name: 3-(3-iodophenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene. InChIKey: QJXIPDWLWOMOGB-UHFFFAOYSA-N.
| Molecular formula | C16H12BIN2 |
|---|---|
| Molecular weight | 370.0 g/mol |
| IUPAC name | 3-(3-iodophenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| InChIKey | QJXIPDWLWOMOGB-UHFFFAOYSA-N |
| SMILES | B1(NC2=CC=CC3=C2C(=CC=C3)N1)C4=CC(=CC=C4)I |
Computed by PubChem (NCBI)