Products 137037-20-8
CAS 137037-20-8 appears in our catalog under these names: (2R,2'R)–2,2'–Bipyrrolidine, (2R，2'R)-2，2'-Bipyrrolidine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 50mg.
(2R)-2-[(2R)-pyrrolidin-2-yl]pyrrolidine (CAS 137037-20-8) is a chemical compound with the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. IUPAC name: (2R)-2-[(2R)-pyrrolidin-2-yl]pyrrolidine. InChIKey: NQHVTVSAFRAXPA-HTQZYQBOSA-N.
| Molecular formula | C8H16N2 |
|---|---|
| Molecular weight | 140.23 g/mol |
| IUPAC name | (2R)-2-[(2R)-pyrrolidin-2-yl]pyrrolidine |
| InChIKey | NQHVTVSAFRAXPA-HTQZYQBOSA-N |
| SMILES | C1C[C@@H](NC1)[C@H]2CCCN2 |
Computed by PubChem (NCBI)