CAS 137044-55-4 is the registry number for 9-Hydroxy-2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium perchlorate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium-9-ol perchlorate (CAS 137044-55-4) is a chemical compound with the molecular formula C10H11ClN2O5 and a molecular weight of 274.66 g/mol. IUPAC name: 2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium-9-ol perchlorate. InChIKey: QFLISURJTPOAJI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O5 |
|---|---|
| Molecular weight | 274.66 g/mol |
| IUPAC name | 2,4-dimethylpyrido[1,2-a]pyrimidin-5-ium-9-ol perchlorate |
| InChIKey | QFLISURJTPOAJI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C(C=CC=[N+]12)O)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)