Products 13705-05-0

CAS 13705-05-0 appears in our catalog under these names: 2,4-Dichloro-6-(methylthio)-1,3,5-triazine, 95%, 2,4–Dichloro–6–(methylthio)–1,3,5–triazine, 2,4-Dichloro-6-(methylthio)-1,3,5-triazine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 50mg, 100mg, 10g.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-methylsulfanyl-1,3,5-triazine (CAS 13705-05-0) is a chemical compound with the molecular formula C4H3Cl2N3S and a molecular weight of 196.06 g/mol. IUPAC name: 2,4-dichloro-6-methylsulfanyl-1,3,5-triazine. InChIKey: MWPZLWRHHPWTFS-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3Cl2N3S
Molecular weight196.06 g/mol
IUPAC name2,4-dichloro-6-methylsulfanyl-1,3,5-triazine
InChIKeyMWPZLWRHHPWTFS-UHFFFAOYSA-N
SMILESCSC1=NC(=NC(=N1)Cl)Cl

Computed by PubChem (NCBI)