CAS 1370596-54-5 is the registry number for 8-Amino-7-isopentyl-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
8-amino-1,3-dimethyl-7-(3-methylbutyl)purine-2,6-dione (CAS 1370596-54-5) is a chemical compound with the molecular formula C12H19N5O2 and a molecular weight of 265.31 g/mol. IUPAC name: 8-amino-1,3-dimethyl-7-(3-methylbutyl)purine-2,6-dione. InChIKey: OPVHLSOOWUIVAJ-UHFFFAOYSA-N.
| Molecular formula | C12H19N5O2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 8-amino-1,3-dimethyl-7-(3-methylbutyl)purine-2,6-dione |
| InChIKey | OPVHLSOOWUIVAJ-UHFFFAOYSA-N |
| SMILES | CC(C)CCN1C2=C(N=C1N)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)