CAS 1370598-83-6 is the registry number for 7-Chloro-6-fluoro-1,3,4,5-tetrahydrobenzo[b]-1,6-naphthyridin-10(2h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-chloro-6-fluoro-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one (CAS 1370598-83-6) is a chemical compound with the molecular formula C12H10ClFN2O and a molecular weight of 252.67 g/mol. IUPAC name: 7-chloro-6-fluoro-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one. InChIKey: LAWUFRFHSUNFDI-UHFFFAOYSA-N.
| Molecular formula | C12H10ClFN2O |
|---|---|
| Molecular weight | 252.67 g/mol |
| IUPAC name | 7-chloro-6-fluoro-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one |
| InChIKey | LAWUFRFHSUNFDI-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C(C2=O)C=CC(=C3F)Cl |
Computed by PubChem (NCBI)