CAS 137071-78-4 appears in our catalog under these names: 3,6-Dichlorobenzene-1,2,4-tricarboxylic acid, 95%, 3,6-Dichlorobenzene-1,2,4-tricarboxylic acid, 3,6-Dichlorotrimellitic acid/ 99.58% (existing batch purity), 3,6-Dichlorotrimellitic acid, 3,6-Dichlorotrimellitic acid 97% (<12%H2O). Offered by: Combi-blocks, TRC, TargetMol, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3,6-dichlorobenzene-1,2,4-tricarboxylic acid (CAS 137071-78-4) is a chemical compound with the molecular formula C9H4Cl2O6 and a molecular weight of 279.03 g/mol. IUPAC name: 3,6-dichlorobenzene-1,2,4-tricarboxylic acid. InChIKey: WFLALXNBVTWGKP-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O6 |
|---|---|
| Molecular weight | 279.03 g/mol |
| IUPAC name | 3,6-dichlorobenzene-1,2,4-tricarboxylic acid |
| InChIKey | WFLALXNBVTWGKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)C(=O)O)C(=O)O)Cl)C(=O)O |
Computed by PubChem (NCBI)