Products 137101-74-7
CAS 137101-74-7 appears in our catalog under these names: 1-(2-Chlorophenyl)-2-(4-fluorophenyl)ethan-1-one, 95%, 1-(2-Chlorophenyl)-2-(4-fluorophenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(2-chlorophenyl)-2-(4-fluorophenyl)ethanone (CAS 137101-74-7) is a chemical compound with the molecular formula C14H10ClFO and a molecular weight of 248.68 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-(4-fluorophenyl)ethanone. InChIKey: JAKXQTAJSUAEJA-UHFFFAOYSA-N.
| Molecular formula | C14H10ClFO |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-(4-fluorophenyl)ethanone |
| InChIKey | JAKXQTAJSUAEJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC2=CC=C(C=C2)F)Cl |
Computed by PubChem (NCBI)