CAS 137118-00-4 appears in our catalog under these names: 2-Amino-4-[(2-n-phthalimido)ethyl]thiazole hydrochloride, 95%, 2-(2-(2-Aminothiazol-4-yl)ethyl)isoindoline-1,3-dione hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-[2-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione;hydrochloride (CAS 137118-00-4) is a chemical compound with the molecular formula C13H12ClN3O2S and a molecular weight of 309.77 g/mol. IUPAC name: 2-[2-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione;hydrochloride. InChIKey: NKKRVCKYGBAIPT-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O2S |
|---|---|
| Molecular weight | 309.77 g/mol |
| IUPAC name | 2-[2-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione;hydrochloride |
| InChIKey | NKKRVCKYGBAIPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC3=CSC(=N3)N.Cl |
Computed by PubChem (NCBI)