Products 137125-92-9
CAS 137125-92-9 appears in our catalog under these names: Olivetol-d9, >95% (HPLC), Olivetol-d9. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg, 1 mg, 10 mg.
5-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)benzene-1,3-diol (CAS 137125-92-9) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 189.30 g/mol. IUPAC name: 5-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)benzene-1,3-diol. InChIKey: IRMPFYJSHJGOPE-YNSOAAEFSA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 5-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)benzene-1,3-diol |
| InChIKey | IRMPFYJSHJGOPE-YNSOAAEFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CC1=CC(=CC(=C1)O)O |
Computed by PubChem (NCBI)