Products 137145-75-6

CAS 137145-75-6 is the registry number for Gadobutrol Impurity 94. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(1,4,7,10-tetrazacyclododec-1-yl)acetate (CAS 137145-75-6) is a chemical compound with the molecular formula C14H30N4O2 and a molecular weight of 286.41 g/mol. IUPAC name: tert-butyl 2-(1,4,7,10-tetrazacyclododec-1-yl)acetate. InChIKey: CSKOCUPUEKOSOU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H30N4O2
Molecular weight286.41 g/mol
IUPAC nametert-butyl 2-(1,4,7,10-tetrazacyclododec-1-yl)acetate
InChIKeyCSKOCUPUEKOSOU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CN1CCNCCNCCNCC1

Computed by PubChem (NCBI)