CAS 13716-12-6 appears in our catalog under these names: Tri-tert-butylphosphine, Tri-tert-butylphosphine, 95%, TRI-TERT-BUTYLPHOSPHINE, 1M IN TOLUENE, TRI-TERT-BUTYLPHOSPHINE, 98%, TRI-TERT-BUTYLPHOSPHINE SOLUTION, 1.0 M&. Offered by: Hubei YoungXin, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 5g, 10ML.
Tritert-butylphosphane (CAS 13716-12-6) is a chemical compound with the molecular formula C12H27P and a molecular weight of 202.32 g/mol. IUPAC name: tritert-butylphosphane. InChIKey: BWHDROKFUHTORW-UHFFFAOYSA-N.
| Molecular formula | C12H27P |
|---|---|
| Molecular weight | 202.32 g/mol |
| IUPAC name | tritert-butylphosphane |
| InChIKey | BWHDROKFUHTORW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)