CAS 137174-84-6 appears in our catalog under these names: 2,3,4,5,6-Pentafluorobenzylphosphonic Acid, >98.0%(HPLC)(T), 2,3,4,5,6-PENTAFLUOROBENZYLPHOSPHONIC A&. Offered by: TCI, Sigma-Aldrich. Available pack sizes: 1g, 5g.
(2,3,4,5,6-pentafluorophenyl)methylphosphonic acid (CAS 137174-84-6) is a chemical compound with the molecular formula C7H4F5O3P and a molecular weight of 262.07 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl)methylphosphonic acid. InChIKey: NTUQIHXUWNQRPZ-UHFFFAOYSA-N.
| Molecular formula | C7H4F5O3P |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl)methylphosphonic acid |
| InChIKey | NTUQIHXUWNQRPZ-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)P(=O)(O)O |
Computed by PubChem (NCBI)