Products 13720-08-6
CAS 13720-08-6 appears in our catalog under these names: 1,4-Di(methyl-d3)-naphthalene, >95% (HPLC), 1,4-Bis(methyl-d3)naphthalene. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
1,4-bis(trideuteriomethyl)naphthalene (CAS 13720-08-6) is a chemical compound with the molecular formula C12H12 and a molecular weight of 162.26 g/mol. IUPAC name: 1,4-bis(trideuteriomethyl)naphthalene. InChIKey: APQSQLNWAIULLK-WFGJKAKNSA-N.
| Molecular formula | C12H12 |
|---|---|
| Molecular weight | 162.26 g/mol |
| IUPAC name | 1,4-bis(trideuteriomethyl)naphthalene |
| InChIKey | APQSQLNWAIULLK-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C2=CC=CC=C21)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)