CAS 13720-48-4 is the registry number for 4-Fluoronaphthalen-2-amine, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-fluoronaphthalen-2-amine (CAS 13720-48-4) is a chemical compound with the molecular formula C10H8FN and a molecular weight of 161.18 g/mol. IUPAC name: 4-fluoronaphthalen-2-amine. InChIKey: FRELRPVNUJUIHF-UHFFFAOYSA-N.
| Molecular formula | C10H8FN |
|---|---|
| Molecular weight | 161.18 g/mol |
| IUPAC name | 4-fluoronaphthalen-2-amine |
| InChIKey | FRELRPVNUJUIHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2F)N |
Computed by PubChem (NCBI)