CAS 137203-34-0 is the registry number for BIS(TRIMETHYLALUMINUM)-1,4-DIAZABICYCLO&. Offered by: Sigma-Aldrich. Available pack sizes: 1G, 5G.
1,4-diazabicyclo[2.2.2]octane;bis(trimethylalumane) (CAS 137203-34-0) is a chemical compound with the molecular formula C12H30Al2N2 and a molecular weight of 256.34 g/mol. IUPAC name: 1,4-diazabicyclo[2.2.2]octane;bis(trimethylalumane). InChIKey: WSTAITCRSVOCTK-UHFFFAOYSA-N.
| Molecular formula | C12H30Al2N2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 1,4-diazabicyclo[2.2.2]octane;bis(trimethylalumane) |
| InChIKey | WSTAITCRSVOCTK-UHFFFAOYSA-N |
| SMILES | C[Al](C)C.C[Al](C)C.C1CN2CCN1CC2 |
Computed by PubChem (NCBI)