CAS 1372096-36-0 is the registry number for 2,6-Bis(aminomethyl)-4-bromophenol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride (CAS 1372096-36-0) is a chemical compound with the molecular formula C8H13BrCl2N2O and a molecular weight of 304.01 g/mol. IUPAC name: 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride. InChIKey: KBHRWAAABBDXFR-UHFFFAOYSA-N.
| Molecular formula | C8H13BrCl2N2O |
|---|---|
| Molecular weight | 304.01 g/mol |
| IUPAC name | 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride |
| InChIKey | KBHRWAAABBDXFR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CN)O)CN)Br.Cl.Cl |
Computed by PubChem (NCBI)