CAS 1372133-74-8 is the registry number for (R)-N-(4-Biphenyl) tert-butanesulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-N-(4-phenylphenyl)propane-2-sulfinamide (CAS 1372133-74-8) is a chemical compound with the molecular formula C16H19NOS and a molecular weight of 273.4 g/mol. IUPAC name: 2-methyl-N-(4-phenylphenyl)propane-2-sulfinamide. InChIKey: ROXBWWOGTMOXHI-UHFFFAOYSA-N.
| Molecular formula | C16H19NOS |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 2-methyl-N-(4-phenylphenyl)propane-2-sulfinamide |
| InChIKey | ROXBWWOGTMOXHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)NC1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)