Products 137233-86-4
CAS 137233-86-4 is the registry number for 2-(3,6,7,8-Tetrahydro-1(2H)-pyrenylidene)acetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg.
Ethyl (2E)-2-(3,6,7,8-tetrahydro-2H-pyren-1-ylidene)acetate (CAS 137233-86-4) is a chemical compound with the molecular formula C20H20O2 and a molecular weight of 292.4 g/mol. IUPAC name: ethyl (2E)-2-(3,6,7,8-tetrahydro-2H-pyren-1-ylidene)acetate. InChIKey: NQAIDQQDSNQBJT-FOWTUZBSSA-N.
| Molecular formula | C20H20O2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | ethyl (2E)-2-(3,6,7,8-tetrahydro-2H-pyren-1-ylidene)acetate |
| InChIKey | NQAIDQQDSNQBJT-FOWTUZBSSA-N |
| SMILES | CCOC(=O)/C=C/1\CCC2=C3C1=CC=C4C3=C(CCC4)C=C2 |
Computed by PubChem (NCBI)