Products 1372711-56-2

CAS 1372711-56-2 appears in our catalog under these names: 5-Bromo-2-methyl-2H-1,2,3-triazole-4-carboxylic acid, 95%, 5-Bromo-2-methyl-2H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-bromo-2-methyltriazole-4-carboxylic acid (CAS 1372711-56-2) is a chemical compound with the molecular formula C4H4BrN3O2 and a molecular weight of 206.00 g/mol. IUPAC name: 5-bromo-2-methyltriazole-4-carboxylic acid. InChIKey: MEEKMZNPDDHRHE-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4BrN3O2
Molecular weight206.00 g/mol
IUPAC name5-bromo-2-methyltriazole-4-carboxylic acid
InChIKeyMEEKMZNPDDHRHE-UHFFFAOYSA-N
SMILESCN1N=C(C(=N1)Br)C(=O)O

Computed by PubChem (NCBI)