CAS 1372778-26-1 is the registry number for N-(9,9-Dimethyl-9H-fluoren-2-yl)phenanthren-9-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-(9,9-dimethylfluoren-2-yl)phenanthren-9-amine (CAS 1372778-26-1) is a chemical compound with the molecular formula C29H23N and a molecular weight of 385.5 g/mol. IUPAC name: N-(9,9-dimethylfluoren-2-yl)phenanthren-9-amine. InChIKey: FWHQNOWLAUCQHY-UHFFFAOYSA-N.
| Molecular formula | C29H23N |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | N-(9,9-dimethylfluoren-2-yl)phenanthren-9-amine |
| InChIKey | FWHQNOWLAUCQHY-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=CC5=CC=CC=C5C6=CC=CC=C64)C |
Computed by PubChem (NCBI)