CAS 137278-46-7 is the registry number for 3-Chloro-5,6-methylenedioxybenzothiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-chlorothieno[2,3-f][1,3]benzodioxole-6-carbonyl chloride (CAS 137278-46-7) is a chemical compound with the molecular formula C10H4Cl2O3S and a molecular weight of 275.11 g/mol. IUPAC name: 7-chlorothieno[2,3-f][1,3]benzodioxole-6-carbonyl chloride. InChIKey: GSQHQQCOXOFRNW-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2O3S |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | 7-chlorothieno[2,3-f][1,3]benzodioxole-6-carbonyl chloride |
| InChIKey | GSQHQQCOXOFRNW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=C(S3)C(=O)Cl)Cl |
Computed by PubChem (NCBI)