Products 137278-46-7

CAS 137278-46-7 is the registry number for 3-Chloro-5,6-methylenedioxybenzothiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

7-chlorothieno[2,3-f][1,3]benzodioxole-6-carbonyl chloride (CAS 137278-46-7) is a chemical compound with the molecular formula C10H4Cl2O3S and a molecular weight of 275.11 g/mol. IUPAC name: 7-chlorothieno[2,3-f][1,3]benzodioxole-6-carbonyl chloride. InChIKey: GSQHQQCOXOFRNW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H4Cl2O3S
Molecular weight275.11 g/mol
IUPAC name7-chlorothieno[2,3-f][1,3]benzodioxole-6-carbonyl chloride
InChIKeyGSQHQQCOXOFRNW-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C=C3C(=C2)C(=C(S3)C(=O)Cl)Cl

Computed by PubChem (NCBI)