CAS 1372784-40-1 appears in our catalog under these names: 5-((4-Chlorophenethyl),sulfonyl),-1-phenyl-1H-tetrazole, 95%, 95%, 5-((4-CHLOROPHENETHYL)SULFONYL)-1-PHENYL-1H-TETRAZOLE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
5-[2-(4-chlorophenyl)ethylsulfonyl]-1-phenyltetrazole (CAS 1372784-40-1) is a chemical compound with the molecular formula C15H13ClN4O2S and a molecular weight of 348.8 g/mol. IUPAC name: 5-[2-(4-chlorophenyl)ethylsulfonyl]-1-phenyltetrazole. InChIKey: NAKVUIUBKDCGGQ-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4O2S |
|---|---|
| Molecular weight | 348.8 g/mol |
| IUPAC name | 5-[2-(4-chlorophenyl)ethylsulfonyl]-1-phenyltetrazole |
| InChIKey | NAKVUIUBKDCGGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NN=N2)S(=O)(=O)CCC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)